* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-[2-(2-Propyn-1-yloxy)ethoxy]propanoic acid |
CAS: | 1859379-85-3 |
English Synonyms: | 3-[2-(2-PROPYN-1-YLOXY)ETHOXY]PROPANOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C#C)OCCOCCC(=O)O |
InChi: | InChI=1S/C8H12O4/c1-2-4-11-6-7-12-5-3-8(9)10/h1H,3-7H2,(H,9,10) |
InChiKey: | InChIKey=NNWHATPXNWOQKD-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.