* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IODAMIDE MEGLUMINE |
| CAS: | 18656-21-8 |
| English Synonyms: | IODAMIDE MEGLUMINE |
| MDL Number.: | MFCD01725416 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CC(=O)NCc1c(c(c(c(c1I)NC(=O)C)I)C(=O)O)I.CNC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| InChi: | InChI=1S/C12H11I3N2O4.C7H17NO5/c1-4(18)16-3-6-8(13)7(12(20)21)10(15)11(9(6)14)17-5(2)19;1-8-2-4(10)6(12)7(13)5(11)3-9/h3H2,1-2H3,(H,16,18)(H,17,19)(H,20,21);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChiKey: | InChIKey=UYIPQECISAQMIU-WZTVWXICSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.