* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 10-Azido-decanoic acid |
CAS: | 186788-32-9 |
English Synonyms: | 10-AZIDO-DECANOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])CCCCCCCCCC(=O)O |
InChi: | InChI=1S/C10H19N3O2/c11-13-12-9-7-5-3-1-2-4-6-8-10(14)15/h1-9H2,(H,14,15) |
InChiKey: | InChIKey=LKQUZMZZOUGGHF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.