* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Azetidine, 3-(methylsulfinyl)- |
CAS: | 1872043-87-2 |
English Synonyms: | AZETIDINE, 3-(METHYLSULFINYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CS(=O)C1CNC1 |
InChi: | InChI=1S/C4H9NOS/c1-7(6)4-2-5-3-4/h4-5H,2-3H2,1H3 |
InChiKey: | InChIKey=LJILJXHAHZLBPY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.