* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-BROMO-2,4-DIMETHYL-OXAZOLE |
CAS: | 187399-73-1 |
English Synonyms: | 5-BROMO-2,4-DIMETHYL-OXAZOLE ; 5-BROMO-2,4-DIMETHYL-1,3-OXAZOLE |
MDL Number.: | MFCD16990000 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | Cc1c(oc(n1)C)Br |
InChi: | InChI=1S/C5H6BrNO/c1-3-5(6)8-4(2)7-3/h1-2H3 |
InChiKey: | InChIKey=IPCANAGBSFRNQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.