Molecular Structure:
CAS No.:
187543-70-0
Product Name.:
CCD No.:CCD03283584
Formula:C8 H6 N2 O3
MolWeight:178.146
![7-METHYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(12)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(3)
|
|
| Product Name： | 7-METHYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE |
| CAS： | 187543-70-0 |
| English Synonyms： | 7-METHYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE ; 7-METHYL-2H-PYRIDO[2,3-D][1,3]OXAZINE-2,4(1H)-DIONE ; 7-METHYL-1H,2H,4H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE |
| MDL Number.： | MFCD17011908 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | Cc1ccc2c(n1)[nH]c(=O)oc2=O |
| InChi： | InChI=1S/C8H6N2O3/c1-4-2-3-5-6(9-4)10-8(12)13-7(5)11/h2-3H,1H3,(H,9,10,12) |
| InChiKey： | InChIKey=JMJHWILLNILULW-UHFFFAOYSA-N |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
