* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (1R,2S,4R,5S)-2,5-DIMETHYL-7-PHENYL-7-PHOSPHABICYCLO[2.2.1]HEPTANE |
CAS: | 189210-88-6 |
English Synonyms: | (1R,2S,4R,5S)-2,5-DIMETHYL-7-PHENYL-7-PHOSPHABICYCLO[2.2.1]HEPTANE |
MDL Number.: | MFCD17013271 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C[C@H]1C[C@@H]2[C@H](C[C@H]1P2c3ccccc3)C |
InChi: | InChI=1S/C14H19P/c1-10-8-14-11(2)9-13(10)15(14)12-6-4-3-5-7-12/h3-7,10-11,13-14H,8-9H2,1-2H3/t10-,11-,13+,14+/m0/s1 |
InChiKey: | InChIKey=LUEHQOLJQPSOSN-CDGCEXEKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.