* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3-Propanediamine, N1-1-naphthalenyl- |
CAS: | 190127-72-1 |
English Synonyms: | 1,3-PROPANEDIAMINE, N1-1-NAPHTHALENYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC=CC2=CC=CC=C12)NCCCN |
InChi: | InChI=1S/C13H16N2/c14-9-4-10-15-13-8-3-6-11-5-1-2-7-12(11)13/h1-3,5-8,15H,4,9-10,14H2 |
InChiKey: | InChIKey=NETWUUKWXREPEI-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.