* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-BENZYL-3-METHYLINDOLE |
| CAS: | 19013-50-4 |
| English Synonyms: | 2-BENZYL-3-METHYLINDOLE |
| MDL Number.: | MFCD00475516 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | Cc1c2ccccc2[nH]c1Cc3ccccc3 |
| InChi: | InChI=1S/C16H15N/c1-12-14-9-5-6-10-15(14)17-16(12)11-13-7-3-2-4-8-13/h2-10,17H,11H2,1H3 |
| InChiKey: | InChIKey=IJCUBGSXWJAIOE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.