Molecular Structure:
CAS No.:
19031-57-3
Product Name.:
CCD No.:CCD00211212
Formula:C8 H10 D4 O4
MolWeight:178.219
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 1,8-OCTANEDIOIC-2,2,7,7-D4 ACID |
| CAS： | 19031-57-3 |
| English Synonyms： | SUBERIC ACID-2,2,7,7-D4 ; 1,8-OCTANEDIOIC-2,2,7,7-D4 ACID |
| MDL Number.： | MFCD01317359 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | [2H]C([2H])(CCCCC([2H])([2H])C(=O)O)C(=O)O |
| InChiKey： | InChIKey=null |
|
|
| Information： | 98 ATOM % D |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
