* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-Boc-non-8-yn-1-amine |
CAS: | 1903797-81-8 |
English Synonyms: | N-BOC-NON-8-YN-1-AMINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)NCCCCCCCC#C |
InChi: | InChI=1S/C14H25NO2/c1-5-6-7-8-9-10-11-12-15-13(16)17-14(2,3)4/h1H,6-12H2,2-4H3,(H,15,16) |
InChiKey: | InChIKey=WWESCFLXEXRJNO-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.