* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,6-DICHLORO-7-ETHYL-7H-PURINE |
CAS: | 190654-80-9 |
English Synonyms: | 2,6-DICHLORO-7-ETHYL-7H-PURINE |
MDL Number.: | MFCD16872319 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCn1cnc2c1c(nc(n2)Cl)Cl |
InChi: | InChI=1S/C7H6Cl2N4/c1-2-13-3-10-6-4(13)5(8)11-7(9)12-6/h3H,2H2,1H3 |
InChiKey: | InChIKey=OXRKNOIREWJPSD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.