* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-2-METHYL-1-HEPTENE |
| CAS: | 191488-26-3 |
| English Synonyms: | 7-CHLORO-2-METHYLHEPT-1-ENE ; 7-CHLORO-2-METHYL-1-HEPTENE |
| MDL Number.: | MFCD00671835 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CC(=C)CCCCCCl |
| InChi: | InChI=1S/C8H15Cl/c1-8(2)6-4-3-5-7-9/h1,3-7H2,2H3 |
| InChiKey: | InChIKey=INYVTNOWFXTSFY-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.