* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,6,7,8-TETRAHYDRO-QUINAZOLIN-4-OL |
CAS: | 19178-19-9 |
English Synonyms: | 5,6,7,8-TETRAHYDRO-QUINAZOLIN-4-OL |
MDL Number.: | MFCD02666097 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1nc2c(c(n1)O)CCCC2 |
InChi: | InChI=1S/C8H10N2O/c11-8-6-3-1-2-4-7(6)9-5-10-8/h5H,1-4H2,(H,9,10,11) |
InChiKey: | InChIKey=VLGSBIJEQBQFCJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.