* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,9-DIFLUORO-1,7-PHENANTHROLINE |
CAS: | 191861-18-4 |
English Synonyms: | 3,9-DIFLUORO-1,7-PHENANTHROLINE |
MDL Number.: | MFCD02752674 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc2c(cc(cn2)F)c3c1cc(cn3)F |
InChi: | InChI=1S/C12H6F2N2/c13-8-3-7-1-2-11-10(12(7)16-6-8)4-9(14)5-15-11/h1-6H |
InChiKey: | InChIKey=OMYJICXWQGYTMH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.