* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | [1,1-BIPHENYL]-2,2,3,3-TETROL |
CAS: | 19261-03-1 |
English Synonyms: | [1,1-BIPHENYL]-2,2,3,3-TETROL ; [1,1-BIPHENYL]-2,2',3,3'-TETROL |
MDL Number.: | MFCD11977686 |
H bond acceptor: | 4 |
H bond donor: | 4 |
Smile: | c1cc(c(c(c1)O)O)c2cccc(c2O)O |
InChi: | InChI=1S/C12H10O4/c13-9-5-1-3-7(11(9)15)8-4-2-6-10(14)12(8)16/h1-6,13-16H |
InChiKey: | InChIKey=AIEZFWSIZQLXEG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.