* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GL 205 |
| CAS: | 19293-86-8 |
| English Synonyms: | GL 205 |
| MDL Number.: | MFCD01690928 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1cc(c[n+](c1)CCCCC[n+]2cccc(c2)C(=O)N)C(=O)N.[Br-].[Br-] |
| InChi: | InChI=1S/C17H20N4O2.2BrH/c18-16(22)14-6-4-10-20(12-14)8-2-1-3-9-21-11-5-7-15(13-21)17(19)23;;/h4-7,10-13H,1-3,8-9H2,(H2-2,18,19,22,23);2*1H |
| InChiKey: | InChIKey=OGAOBQVCZLHZLR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.