* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Propanol, 3-[(2-bromophenyl)methoxy]- |
CAS: | 194342-70-6 |
English Synonyms: | 1-PROPANOL, 3-[(2-BROMOPHENYL)METHOXY]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=C(C=CC=C1)COCCCO |
InChi: | InChI=1S/C10H13BrO2/c11-10-5-2-1-4-9(10)8-13-7-3-6-12/h1-2,4-5,12H,3,6-8H2 |
InChiKey: | InChIKey=PJEMEGHTTFJSTQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.