* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | NAPHT-(1'.2',1.2)-ANTHRACENE |
CAS: | 195-06-2 |
English Synonyms: | NAPHT[1,2-A]ANTHRACENE ; NAPHT-(1'.2',1.2)-ANTHRACENE |
MDL Number.: | MFCD02683763 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)ccc3c2c4cc5ccccc5cc4cc3 |
InChi: | InChI=1S/C22H14/c1-2-7-18-14-21-19(13-17(18)6-1)12-11-16-10-9-15-5-3-4-8-20(15)22(16)21/h1-14H |
InChiKey: | InChIKey=HAJMQPPSPOBCLG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.