* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-ALA-SER METHYL ESTER |
CAS: | 19542-34-8 |
English Synonyms: | Z-ALA-SER-OME ; Z-ALA-SER METHYL ESTER |
MDL Number.: | MFCD00056131 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | C[C@@H](C(=O)N[C@@H](CO)C(=O)OC)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C15H20N2O6/c1-10(13(19)17-12(8-18)14(20)22-2)16-15(21)23-9-11-6-4-3-5-7-11/h3-7,10,12,18H,8-9H2,1-2H3,(H,16,21)(H,17,19)/t10-,12-/m0/s1 |
InChiKey: | InChIKey=IDVXGMLTOPUJTE-JQWIXIFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.