* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (1S,6S)-2-(PHENYLSULFONYL)-7-OXA-BICYCLO [4.1.0]HEPT-2-ENE |
CAS: | 195604-53-6 |
English Synonyms: | (1S,6S)-2-(PHENYLSULFONYL)-7-OXA-BICYCLO [4.1.0]HEPT-2-ENE |
MDL Number.: | MFCD16876442 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)S(=O)(=O)C2=CCC[C@H]3[C@@H]2O3 |
InChi: | InChI=1S/C12H12O3S/c13-16(14,9-5-2-1-3-6-9)11-8-4-7-10-12(11)15-10/h1-3,5-6,8,10,12H,4,7H2/t10-,12-/m0/s1 |
InChiKey: | InChIKey=CUIXDYPPWPJZND-JQWIXIFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.