* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OMTRIPTOLIDE |
| CAS: | 195883-06-8 |
| English Synonyms: | OMTRIPTOLIDE |
| MDL Number.: | MFCD09954137 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | CC(C)[C@@]12[C@@H](O1)[C@H]3[C@@]4(O3)[C@]5(CCC6=C([C@@H]5C[C@H]7[C@]4([C@@H]2OC(=O)CCC(=O)O)O7)COC6=O)C |
| InChi: | InChI=1S/C24H28O9/c1-10(2)22-17(32-22)18-24(33-18)21(3)7-6-11-12(9-29-19(11)28)13(21)8-14-23(24,31-14)20(22)30-16(27)5-4-15(25)26/h10,13-14,17-18,20H,4-9H2,1-3H3,(H,25,26)/t13-,14-,17-,18-,20+,21-,22-,23+,24+/m0/s1 |
| InChiKey: | InChIKey=HROMYAWHLUOUPY-AHCCQAQQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.