Molecular Structure:
CAS No.:
1967-89-1
Product Name.:
CCD No.:CCD00047662
Formula:C10 H12 Cl2
MolWeight:203.111
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 1,4-DICHLORO-2,3,5,6-TETRAMETHYLBENZENE |
| CAS： | 1967-89-1 |
| English Synonyms： | 1,4-DICHLORODURENE ; 1,4-DICHLORO-2,3,5,6-TETRAMETHYLBENZENE |
| MDL Number.： | MFCD00075230 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | Cc1c(c(c(c(c1Cl)C)C)Cl)C |
| InChi： | InChI=1S/C10H12Cl2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h1-4H3 |
| InChiKey： | InChIKey=PTIQIITULDNGAF-UHFFFAOYSA-N |
|
|
| Comments： | WGK: 3 |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
