* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XENOCYANINE |
CAS: | 19764-90-0 |
English Synonyms: | XENOCYANINE |
MDL Number.: | MFCD00050329 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC[n+]1ccc(c2c1cccc2)/C=C/C=C/C=C/C=C\3/C=CN(c4c3cccc4)CC.[I-] |
InChi: | InChI=1S/C29H29N2.HI/c1-3-30-22-20-24(26-16-10-12-18-28(26)30)14-8-6-5-7-9-15-25-21-23-31(4-2)29-19-13-11-17-27(25)29;/h5-23H,3-4H2,1-2H3;1H/q+1;/p-1 |
InChiKey: | InChIKey=LUQKIGFQQBCZCS-UHFFFAOYSA-M |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.