* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HYPOXANTHINE 3-N-OXIDE |
CAS: | 19765-65-2 |
English Synonyms: | HYPOXANTHINE 3-N-OXIDE |
MDL Number.: | MFCD11656388 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1[nH]c2c(=O)[nH]c[n+](c2n1)[O-] |
InChi: | InChI=1S/C5H4N4O2/c10-5-3-4(7-1-6-3)9(11)2-8-5/h1-2H,(H,6,7)(H,8,10) |
InChiKey: | InChIKey=CPIUTOFQEKHTNJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.