* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABT-594 |
CAS: | 198283-73-7 |
English Synonyms: | ABT-594 ; 5-[((2R)-AZETIDIN-2-YL)METHOXY]-2-CHLOROPYRIDINE |
MDL Number.: | MFCD01758464 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(ncc1OC[C@H]2CCN2)Cl |
InChi: | InChI=1S/C9H11ClN2O/c10-9-2-1-8(5-12-9)13-6-7-3-4-11-7/h1-2,5,7,11H,3-4,6H2/t7-/m1/s1 |
InChiKey: | InChIKey=MKTAGSRKQIGEBH-SSDOTTSWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.