* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Y-33075 |
| CAS: | 199433-58-4 |
| English Synonyms: | Y-33075 ; (R)-4-(1-AMINOETHYL)-N-1H-PYRROLO[2,3-B]PYRIDIN-4-YLBENZAMIDE ; BENZAMIDE, 4-[(1R)-1-AMINOETHYL]-N-1H-PYRROLO[2,3-B]PYRIDIN-4-YL- |
| MDL Number.: | MFCD16038858 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | C[C@H](c1ccc(cc1)C(=O)Nc2ccnc3c2cc[nH]3)N |
| InChi: | InChI=1S/C16H16N4O/c1-10(17)11-2-4-12(5-3-11)16(21)20-14-7-9-19-15-13(14)6-8-18-15/h2-10H,17H2,1H3,(H2,18,19,20,21)/t10-/m1/s1 |
| InChiKey: | InChIKey=JTVBXQAYBIJXRP-SNVBAGLBSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.