* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2,1,3-BENZOTHIADIAZOL-5-YL) ALANINE |
| CAS: | 20032-76-2 |
| English Synonyms: | 3-(2,1,3-BENZOTHIADIAZOL-5-YL) ALANINE |
| MDL Number.: | MFCD00753685 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1cc2c(cc1CC(C(=O)O)N)nsn2 |
| InChi: | InChI=1S/C9H9N3O2S/c10-6(9(13)14)3-5-1-2-7-8(4-5)12-15-11-7/h1-2,4,6H,3,10H2,(H,13,14) |
| InChiKey: | InChIKey=CJWNGYXLGGOAKK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.