* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Pentanamine, 5-(4-chlorophenoxy)- |
CAS: | 200484-40-8 |
English Synonyms: | 1-PENTANAMINE, 5-(4-CHLOROPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC1=CC=C(OCCCCCN)C=C1 |
InChi: | InChI=1S/C11H16ClNO/c12-10-4-6-11(7-5-10)14-9-3-1-2-8-13/h4-7H,1-3,8-9,13H2 |
InChiKey: | InChIKey=RIPBVIMAJIKRLM-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.