* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6H-BENZO[C]CHROMEN-6-ONE |
CAS: | 2005-10-9 |
English Synonyms: | 6H-DIBENZO-(B,D)-PYRAN-6-ONE ; RARECHEM FH 1R W008 ; 6H-BENZO[C]CHROMEN-6-ONE |
MDL Number.: | MFCD00027376 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)c3ccccc3oc2=O |
InChi: | InChI=1S/C13H8O2/c14-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)15-13/h1-8H |
InChiKey: | InChIKey=TVKNXKLYVUVOCV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.