* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Propanol, 3-[(3-methoxyphenyl)methoxy]- |
CAS: | 2008294-78-6 |
English Synonyms: | 1-PROPANOL, 3-[(3-METHOXYPHENYL)METHOXY]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | COC=1C=C(C=CC1)COCCCO |
InChi: | InChI=1S/C11H16O3/c1-13-11-5-2-4-10(8-11)9-14-7-3-6-12/h2,4-5,8,12H,3,6-7,9H2,1H3 |
InChiKey: | InChIKey=BAGQOAGGZARJON-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.