* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,3-DINITROBENZENE-13C6 |
| CAS: | 201595-60-0 |
| English Synonyms: | 1,3-DINITROBENZENE-13C6 |
| MDL Number.: | MFCD00142531 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | [13cH]1[13cH][13c]([13cH][13c]([13cH]1)[N+](=O)[O-])[N+](=O)[O-] |
| InChi: | InChI=1S/C6H4N2O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChiKey: | InChIKey=WDCYWAQPCXBPJA-IDEBNGHGSA-N |
|
|
| Melting Point: | 88-90 DEG C(LIT) |
| Boiling Point: | 297 DEG C(LIT) |
| Density: | DENSITY: 1.416 G/ML AT 25 DEG C |
| Physical Property: | FLASHPOINT: 150 DEG C FLASHPOINT: 302 DEG F |
| Comments: | MASS SHIFT: M+6 RIDADR: UN 3443 6.1/PG 2 UNSPSC: 12142200 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 174.01 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.