* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-GLY-GLY-PHE-BNA |
CAS: | 202001-87-4 |
English Synonyms: | Z-GLY-GLY-PHE-BNA |
MDL Number.: | MFCD00238455 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)Nc2ccc3ccccc3c2)NC(=O)CNC(=O)CNC(=O)OCc4ccccc4 |
InChi: | InChI=1S/C31H30N4O5/c36-28(19-33-31(39)40-21-23-11-5-2-6-12-23)32-20-29(37)35-27(17-22-9-3-1-4-10-22)30(38)34-26-16-15-24-13-7-8-14-25(24)18-26/h1-16,18,27H,17,19-21H2,(H,32,36)(H,33,39)(H,34,38)(H,35,37)/t27-/m0/s1 |
InChiKey: | InChIKey=GGXIYPDVQYNSEL-MHZLTWQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.