* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(2-HYDROXYPHENYL)-2-OXAZOLINE |
| CAS: | 20237-92-7 |
| English Synonyms: | 2-(2-HYDROXYPHENYL)-2-OXAZOLINE ; 2-(4,5-DIHYDRO-1,3-OXAZOL-2-YL)PHENOL |
| MDL Number.: | MFCD17169835 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc(c(c1)C2=NCCO2)O |
| InChi: | InChI=1S/C9H9NO2/c11-8-4-2-1-3-7(8)9-10-5-6-12-9/h1-4,11H,5-6H2 |
| InChiKey: | InChIKey=FETLPNKZRXDWLT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.