Molecular Structure:
CAS No.:
2033-83-2
Product Name.:
CCD No.:CCD00185342
Formula:C11 H15 Br O2
MolWeight:259.142
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(12)
- Buyers(0)
- Spectrum(0)
- MSDS(1)
- Price(5)
|
|
| Product Name： | 1-(4-BROMOBUTOXY)-4-METHOXY-BENZENE |
| CAS： | 2033-83-2 |
| English Synonyms： | 1-(4-BROMOBUTOXY)-4-METHOXY-BENZENE |
| MDL Number.： | MFCD00980264 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | COc1ccc(cc1)OCCCCBr |
| InChi： | InChI=1S/C11H15BrO2/c1-13-10-4-6-11(7-5-10)14-9-3-2-8-12/h4-7H,2-3,8-9H2,1H3 |
| InChiKey： | InChIKey=XNMUBVHIMDDDNF-UHFFFAOYSA-N |
|
|
| Boiling Point： | 98-105 DEG/0.18MM |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
