* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 2,4,6-TRI-TERT-BUTYLPYRIDINE |
| CAS: | 20336-15-6 |
| EnglishSynonyms: | 2,4,6-TRI-TERT-BUTYLPYRIDINE |
| pro_mdlNumber: | MFCD00027417 |
| pro_acceptors: | 1 |
| pro_donors: | 0 |
| pro_smile: | CC(C)(C)c1cc(nc(c1)C(C)(C)C)C(C)(C)C |
| InChi: | InChI=1S/C17H29N/c1-15(2,3)12-10-13(16(4,5)6)18-14(11-12)17(7,8)9/h10-11H,1-9H3 |
| InChiKey: | InChIKey=IDOFMGSESVXXQI-UHFFFAOYSA-N |
|
|
| MeltingPoint: | 67-71 DEG C(LIT) |
| Boiling_Point: | 115-120 DEG C/20 MMHG(LIT) |
| Comments: | STORAGE TEMPERATURE: 2-8 DEG C UNSPSC: 12352100 WGK: 3 |
|
|
| secure_symbol: |
GHS07
|
| secure_signal_word: | Warning |
| secure_risk_stmt: | H315-H319-H335 |
| secure_cautionary_stmt: | P261-P305 + P351 + P338 |
| secure_damage_code: | Xi |
| secure_risk_disclosure_stmt: | R:36/37/38 |
| secure_security_stmt: | S:26-36/37/39 |
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.