* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHOLINE BROMIDE (D13) |
| CAS: | 203645-64-1 |
| English Synonyms: | CHOLINE BROMIDE (D13) ; CHOLINE-D13 BROMIDE (N,N,N-TRIMETHYL-D9, 1,1,2,2-D4) |
| MDL Number.: | MFCD00143966 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | [2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])O.[Br-] |
| InChiKey: | InChIKey=null |
|
|
| Comments: | MASS SHIFT: M+13 WGK: 3 |
| Information: | ISOTOPIC PURITY: 98 ATOM % D MW: 196.89 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.