* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3-Aminophenyl)arsonic acid |
CAS: | 2038-72-4 |
English Synonyms: | (3-AMINOPHENYL)ARSONIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NC=1C=C(C=CC1)[As](O)(O)=O |
InChi: | InChI=1S/C6H8AsNO3/c8-6-3-1-2-5(4-6)7(9,10)11/h1-4H,8H2,(H2,9,10,11) |
InChiKey: | InChIKey=YZLXCCDGHDKATQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.