* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(1H-1,2,3-BENZOTRIAZOL-1-YL)BUTAN-2-ONE |
CAS: | 2038-93-9 |
English Synonyms: | 4-(1H-BENZO[D][1,2,3]TRIAZOL-1-YL)BUTAN-2-ONE ; 4-(1H-1,2,3-BENZOTRIAZOL-1-YL)BUTAN-2-ONE |
MDL Number.: | MFCD00963795 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC(=O)CCn1c2ccccc2nn1 |
InChi: | InChI=1S/C10H11N3O/c1-8(14)6-7-13-10-5-3-2-4-9(10)11-12-13/h2-5H,6-7H2,1H3 |
InChiKey: | InChIKey=CIHZUALRGFSWGT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.