* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-BROMO-6-IODOPHENOL |
CAS: | 2040-86-0 |
English Synonyms: | 2-BROMO-6-IODOPHENOL ; PHENOL, 2-BROMO-6-IODO- |
MDL Number.: | MFCD16999870 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(c(c(c1)I)O)Br |
InChi: | InChI=1S/C6H4BrIO/c7-4-2-1-3-5(8)6(4)9/h1-3,9H |
InChiKey: | InChIKey=ZZBRPSNXUDZTRX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.