* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYL-9H-PURINE |
CAS: | 20427-22-9 |
English Synonyms: | 9H-PURINE, 9-METHYL- ; 9-METHYL-9H-PURINE |
MDL Number.: | MFCD00234187 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cn1cnc2c1ncnc2 |
InChi: | InChI=1S/C6H6N4/c1-10-4-9-5-2-7-3-8-6(5)10/h2-4H,1H3 |
InChiKey: | InChIKey=VRZWCYZJGUYTKU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.