* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EVECARBAMATE |
CAS: | 204442-82-0 |
English Synonyms: | EVECARBAMATE |
MDL Number.: | MFCD02660939 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C(C(C(OC(C(OC#CF)(F)F)(C(F)(F)F)F)(F)F)(F)F)OC(=O)N |
InChi: | InChI=1S/C9H4F11NO4/c10-1-2-24-9(19,20)6(13,7(14,15)16)25-8(17,18)5(11,12)3-23-4(21)22/h3H2,(H2,21,22) |
InChiKey: | InChIKey=UTFQFSRIJRXLCF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.