* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Ethyl 11-azidoundecanoate |
CAS: | 2050905-86-5 |
English Synonyms: | ETHYL 11-AZIDOUNDECANOATE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])CCCCCCCCCCC(=O)OCC |
InChi: | InChI=1S/C13H25N3O2/c1-2-18-13(17)11-9-7-5-3-4-6-8-10-12-15-16-14/h2-12H2,1H3 |
InChiKey: | InChIKey=XJKSQNYXNAKXEV-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.