* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-METHYL-MORPHOLIN-3-ONE |
CAS: | 20721-78-2 |
English Synonyms: | 4-METHYL-MORPHOLIN-3-ONE |
MDL Number.: | MFCD17292768 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CN1CCOCC1=O |
InChi: | InChI=1S/C5H9NO2/c1-6-2-3-8-4-5(6)7/h2-4H2,1H3 |
InChiKey: | InChIKey=FGQBGDBLZZPFCM-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.