* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-CHLORO-1-PENTEN-3-ONE |
CAS: | 20757-87-3 |
English Synonyms: | 5-CHLORO-1-PENTEN-3-ONE ; 5-CHLOROPENT-1-EN-3-ONE |
MDL Number.: | MFCD17013418 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C=CC(=O)CCCl |
InChi: | InChI=1S/C5H7ClO/c1-2-5(7)3-4-6/h2H,1,3-4H2 |
InChiKey: | InChIKey=XLFDSXRUZDTNER-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.