* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-(2-CARBOXYETHYL)-N-[2-(2,5-DIHYDRO-2,5-DIOXO-1H- |
CAS: | 207612-83-7 ;207612-84-8 |
English Synonyms: | N-(2-CARBOXYETHYL)-N-[2-(2,5-DIHYDRO-2,5-DIOXO-1H- |
MDL Number.: | MFCD16876286 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | C1=CC(=O)N(C1=O)CCN(CCC(=O)O)CCC(=O)O |
InChi: | InChI=1S/C12H16N2O6/c15-9-1-2-10(16)14(9)8-7-13(5-3-11(17)18)6-4-12(19)20/h1-2H,3-8H2,(H,17,18)(H,19,20) |
InChiKey: | InChIKey=LVXYEQQFMTUMLX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.