* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | O-TOLUIC-D7 ACID |
CAS: | 207742-73-2 |
English Synonyms: | O-TOLUIC-D7 ACID ; 2-METHYLBENZOIC ACID-D7 |
MDL Number.: | MFCD00002478 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | [2H]C1=C([2H])C(C(O)=O)=C(C([2H])=C1[2H])C([2H])([2H])[2H] |
InChi: | InChI=1S/C8H8O2/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3,(H,9,10)/i1D3,2D,3D,4D,5D |
InChiKey: | InChIKey=ZWLPBLYKEWSWPD-AAYPNNLASA-N |
Property |
|
Information: | 98 ATOM % D |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.