* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-PHENYL-2-BUTENE |
CAS: | 2082-61-3 |
English Synonyms: | 2-PHENYL-2-BUTENE |
MDL Number.: | MFCD00060867 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C/C=C(/C)\c1ccccc1 |
InChi: | InChI=1S/C10H12/c1-3-9(2)10-7-5-4-6-8-10/h3-8H,1-2H3/b9-3- |
InChiKey: | InChIKey=UGUYQBMBIJFNRM-OQFOIZHKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.