* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Hexanoic acid, 6-amino-2-azido-, (2S)- |
CAS: | 2088916-76-9 |
English Synonyms: | HEXANOIC ACID, 6-AMINO-2-AZIDO-, (2S)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NCCCC[C@@H](C(=O)O)N=[N+]=[N-] |
InChi: | InChI=1S/C6H12N4O2/c7-4-2-1-3-5(6(11)12)9-10-8/h5H,1-4,7H2,(H,11,12)/t5-/m0/s1 |
InChiKey: | InChIKey=VCVVFUFHEYFMAK-YFKPBYRVSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.