* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GOUGEROTIN |
| CAS: | 2096-42-6 |
| English Synonyms: | GOUGEROTIN |
| MDL Number.: | MFCD00079309 |
| H bond acceptor: | 15 |
| H bond donor: | 8 |
| Smile: | CNCC(=O)N[C@H](CO)C(=O)N[C@H]1[C@@H]([C@H]([C@@H](O[C@@H]1C(=O)N)n2ccc(nc2=O)N)O)O |
| InChi: | InChI=1S/C16H25N7O8/c1-19-4-8(25)20-6(5-24)14(29)22-9-10(26)11(27)15(31-12(9)13(18)28)23-3-2-7(17)21-16(23)30/h2-3,6,9-12,15,19,24,26-27H,4-5H2,1H3,(H2,18,28)(H,20,25)(H,22,29)(H2,17,21,30)/t6-,9+,10+,11-,12+,15-/m1/s1 |
| InChiKey: | InChIKey=AMNAZJFEONUVTD-QJHHURCWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.